* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Methionine, N-methyl- |
CAS: | 804517-73-5 |
English Synonyms: | METHIONINE, N-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN[C@@H](CCSC)C(=O)O |
InChi: | InChI=1S/C6H13NO2S/c1-7-5(6(8)9)3-4-10-2/h5,7H,3-4H2,1-2H3,(H,8,9)/t5-/m0/s1 |
InChiKey: | InChIKey=YAXAFCHJCYILRU-YFKPBYRVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.