* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRIDO[4,3-B]INDOLE, 2,3,4,5-TETRAHYDRO-1,2,4-TRIMETHYL- |
CAS: | 806617-47-0 |
English Synonyms: | 2,3,4,5-TETRAHYDRO-1,2,4-TRIMETHYL-1H-PYRIDO[4,3-B]INDOLE ; 1H-PYRIDO[4,3-B]INDOLE, 2,3,4,5-TETRAHYDRO-1,2,4-TRIMETHYL- |
MDL Number.: | MFCD09751643 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC1CN(C(c2c1[nH]c3c2cccc3)C)C |
InChi: | InChI=1S/C14H18N2/c1-9-8-16(3)10(2)13-11-6-4-5-7-12(11)15-14(9)13/h4-7,9-10,15H,8H2,1-3H3 |
InChiKey: | InChIKey=WETYFPWYVNXIFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.