* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ALLYLPYRIDIN-3-OL |
| CAS: | 807373-62-2 |
| English Synonyms: | 3-PYRIDINOL, 2-(2-PROPEN-1-YL)- ; 2-(PROP-2-EN-1-YL)PYRIDIN-3-OL ; 2-ALLYLPYRIDIN-3-OL ; 2-(2-PROPEN-1-YL)-3-PYRIDINOL |
| MDL Number.: | MFCD13176027 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C=CCc1c(cccn1)O |
| InChi: | InChI=1S/C8H9NO/c1-2-4-7-8(10)5-3-6-9-7/h2-3,5-6,10H,1,4H2 |
| InChiKey: | InChIKey=UBLVZSDOINBVQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.