* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BENZO[D]ISOXAZOL-5-OL |
| CAS: | 808755-45-5 |
| English Synonyms: | BENZO[D]ISOXAZOL-5-OL ; 1,2-BENZOXAZOL-5-OL |
| MDL Number.: | MFCD13190364 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1O)cno2 |
| InChi: | InChI=1S/C7H5NO2/c9-6-1-2-7-5(3-6)4-8-10-7/h1-4,9H |
| InChiKey: | InChIKey=SZLDGOXCELBEBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.