* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EDOGESTRONE |
| CAS: | 809-01-8 |
| English Synonyms: | EDOGESTRONE |
| MDL Number.: | MFCD00867884 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1=C2CC3(CC[C@@]2([C@H]4CC[C@]5([C@H]([C@@H]4C1)CC[C@@]5(C(=O)C)OC(=O)C)C)C)OCCO3 |
| InChi: | InChI=1S/C26H38O5/c1-16-14-19-20(23(4)10-11-25(15-22(16)23)29-12-13-30-25)6-8-24(5)21(19)7-9-26(24,17(2)27)31-18(3)28/h19-21H,6-15H2,1-5H3/t19-,20+,21+,23-,24+,26+/m1/s1 |
| InChiKey: | InChIKey=UOYMGHSCINLOBK-ZKKYLISVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.