* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(5-OXAHEPTYLOXY)-3-(1H-TETRAZOL-5-YL)COUMARIN |
| CAS: | 80916-87-6 |
| English Synonyms: | 8-(5-OXAHEPTYLOXY)-3-(1H-TETRAZOL-5-YL)COUMARIN |
| MDL Number.: | MFCD01762833 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CCOCCCCOc1cccc2c1oc(=O)c(c2)c3[nH]nnn3 |
| InChi: | InChI=1S/C16H18N4O4/c1-2-22-8-3-4-9-23-13-7-5-6-11-10-12(15-17-19-20-18-15)16(21)24-14(11)13/h5-7,10H,2-4,8-9H2,1H3,(H,17,18,19,20) |
| InChiKey: | InChIKey=BLWURIRWYIJULF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.