* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(2-(2-PROPENYLOXY)ETHOXY)-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
| CAS: | 80916-88-7 |
| English Synonyms: | 8-(2-(2-PROPENYLOXY)ETHOXY)-3-(1H-TETRAZOL-5-YL)-2H-1-BENZOPYRAN-2-ONE |
| MDL Number.: | MFCD01762877 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | C=CCOCCOc1cccc2c1oc(=O)c(c2)c3[nH]nnn3 |
| InChi: | InChI=1S/C15H14N4O4/c1-2-6-21-7-8-22-12-5-3-4-10-9-11(14-16-18-19-17-14)15(20)23-13(10)12/h2-5,9H,1,6-8H2,(H,16,17,18,19) |
| InChiKey: | InChIKey=CJMQNDLHXVWERS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.