* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMETHYSTOIDIN A |
CAS: | 81126-70-7 |
English Synonyms: | AMETHYSTOIDIN A |
MDL Number.: | MFCD00238533 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC1(CCC[C@@]2([C@@H]1C[C@H]([C@]34[C@H]2C(=O)C[C@H]([C@@H]3O)C(=C)C4=O)O)CO)C |
InChi: | InChI=1S/C20H28O5/c1-10-11-7-12(22)15-19(9-21)6-4-5-18(2,3)13(19)8-14(23)20(15,16(10)24)17(11)25/h11,13-15,17,21,23,25H,1,4-9H2,2-3H3/t11-,13+,14+,15-,17-,19-,20+/m0/s1 |
InChiKey: | InChIKey=QNSMDRVETBBHCI-AECLYTTOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.