* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-CHLORO-5H-PYRIMIDO[5,4-B]INDOL-8-OL |
CAS: | 812675-67-5 |
English Synonyms: | 5H-PYRIMIDO[5,4-B]INDOL-8-OL, 4-CHLORO- ; 4-CHLORO-5H-PYRIMIDO[5,4-B]INDOL-8-OL |
MDL Number.: | MFCD17013014 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1O)c3c([nH]2)c(ncn3)Cl |
InChi: | InChI=1S/C10H6ClN3O/c11-10-9-8(12-4-13-10)6-3-5(15)1-2-7(6)14-9/h1-4,14-15H |
InChiKey: | InChIKey=GLZSGVUOUJZGDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.