* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1,4-DIAZEPAN-1-YL)-3-PHENYLPROPAN-1-ONE |
CAS: | 815650-82-9 |
English Synonyms: | 1-(1,4-DIAZEPAN-1-YL)-3-PHENYLPROPAN-1-ONE ; 1-(3-PHENYLPROPANOYL)-1,4-DIAZEPANE |
MDL Number.: | MFCD05879205 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CCC(=O)N2CCCNCC2 |
InChi: | InChI=1S/C14H20N2O/c17-14(16-11-4-9-15-10-12-16)8-7-13-5-2-1-3-6-13/h1-3,5-6,15H,4,7-12H2 |
InChiKey: | InChIKey=MJMYUSDGTVLVNX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.