* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-3-DECEN-1-YL ACETATE |
| CAS: | 81634-99-3 |
| English Synonyms: | Z-3-DECEN-1-YL ACETATE |
| MDL Number.: | MFCD00065426 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCCC/C=C\CCOC(=O)C |
| InChi: | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h8-9H,3-7,10-11H2,1-2H3/b9-8- |
| InChiKey: | InChIKey=HYSSAOQHKOCKIC-HJWRWDBZSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.