* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-AMINO-8-NAPHTHOL-2,4-DISULFONIC ACID |
| CAS: | 82-47-3 |
| English Synonyms: | SS ACID ; 1-AMINO-8-NAPHTHOL-2,4-DISULFONIC ACID |
| MDL Number.: | MFCD00035727 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1cc2c(cc(c(c2c(c1)O)N)S(=O)(=O)O)S(=O)(=O)O |
| InChi: | InChI=1S/C10H9NO7S2/c11-10-8(20(16,17)18)4-7(19(13,14)15)5-2-1-3-6(12)9(5)10/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChiKey: | InChIKey=ZFRBZRZEKIOGQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.