* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENINDAMINE |
| CAS: | 82-88-2 |
| English Synonyms: | PHENINDAMINE |
| MDL Number.: | MFCD00865675 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CN1CCC2=C(C1)C(c3c2cccc3)c4ccccc4 |
| InChi: | InChI=1S/C19H19N/c1-20-12-11-16-15-9-5-6-10-17(15)19(18(16)13-20)14-7-3-2-4-8-14/h2-10,19H,11-13H2,1H3 |
| InChiKey: | InChIKey=ISFHAYSTHMVOJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.