* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GUANYL-DAMME |
| CAS: | 82017-64-9 |
| English Synonyms: | GUANYL-DAMME |
| MDL Number.: | MFCD00236991 |
| H bond acceptor: | 14 |
| H bond donor: | 8 |
| Smile: | C[C@H](C(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)C)CO)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=N)N |
| InChi: | InChI=1S/C30H43N7O7S/c1-19(34-28(42)24(36-30(31)32)15-21-9-11-23(39)12-10-21)27(41)33-17-26(40)37(2)25(16-20-7-5-4-6-8-20)29(43)35-22(18-38)13-14-45(3)44/h4-12,19,22,24-25,38-39H,13-18H2,1-3H3,(H,33,41)(H,34,42)(H,35,43)(H4,31,32,36)/t19-,22+,24+,25+,45?/m1/s1 |
| InChiKey: | InChIKey=OVQNFRFEYUZEKB-UVNGQUMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.