* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 11H-DIBENZO[B,E][1,4]DIAZEPIN-11-ONE, 2-CHLORO-5,10-DIHYDRO |
| CAS: | 82096-44-4 |
| English Synonyms: | 11H-DIBENZO[B,E][1,4]DIAZEPIN-11-ONE, 2-CHLORO-5,10-DIHYDRO ; 2-CHLORO-10,11-DIHYDRO-5H-DIBENZO[B,E][1,4]DIAZEPIN-11-ONE |
| MDL Number.: | MFCD12828637 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)Nc3ccc(cc3C(=O)N2)Cl |
| InChi: | InChI=1S/C13H9ClN2O/c14-8-5-6-10-9(7-8)13(17)16-12-4-2-1-3-11(12)15-10/h1-7,15H,(H,16,17) |
| InChiKey: | InChIKey=DJOORGSPIHHCOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.