* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[3.2.1]-2-OCTENE |
| CAS: | 823-02-9 |
| English Synonyms: | BICYCLO[3.2.1]OCT-2-ENE ; BICYCLO[3.2.1]-2-OCTENE |
| MDL Number.: | MFCD00078236 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C1C[C@H]2C[C@@H]1CC=C2 |
| InChi: | InChI=1S/C8H12/c1-2-7-4-5-8(3-1)6-7/h1-2,7-8H,3-6H2/t7-,8+/m0/s1 |
| InChiKey: | InChIKey=YEHSTKKZWWSIMD-JGVFFNPUSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.