* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EXO-5-ACETYL-2-NORBORNENE |
| CAS: | 824-61-3 |
| English Synonyms: | EXO-5-ACETYL-2-NORBORNENE |
| MDL Number.: | MFCD14155887 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(=O)[C@H]1C[C@H]2C[C@@H]1C=C2 |
| InChi: | InChI=1S/C9H12O/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-5H2,1H3/t7-,8+,9-/m1/s1 |
| InChiKey: | InChIKey=NIMLCWCLVJRPFY-HRDYMLBCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.