* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IODOBENZENE, [14C(U)] |
| CAS: | 82460-32-0 |
| English Synonyms: | IODOBENZENE, [14C(U)] |
| MDL Number.: | MFCD00216399 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | [14cH]1[14cH][14cH][14c]([14cH][14cH]1)I |
| InChi: | InChI=1S/C6H5I/c7-6-4-2-1-3-5-6/h1-5H/i1+2,2+2,3+2,4+2,5+2,6+2 |
| InChiKey: | InChIKey=SNHMUERNLJLMHN-YROCTSJKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.