* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ 20788560 |
CAS: | 825649-28-3 |
English Synonyms: | JNJ 20788560 |
MDL Number.: | MFCD17167086 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC)C(=O)c1ccc2c(c1)Oc3ccccc3C2=C4CC5CCC(C4)N5 |
InChi: | InChI=1S/C25H28N2O2/c1-3-27(4-2)25(28)16-9-12-21-23(15-16)29-22-8-6-5-7-20(22)24(21)17-13-18-10-11-19(14-17)26-18/h5-9,12,15,18-19,26H,3-4,10-11,13-14H2,1-2H3 |
InChiKey: | InChIKey=MISSUZBVOCUXTG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.