* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VUFB-10710 |
| CAS: | 82875-64-7 |
| English Synonyms: | VUFB-10710 |
| MDL Number.: | MFCD01720030 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CN(C)CCc1c2c(cc3c1CCC3)CCC2.Cl |
| InChi: | InChI=1S/C16H23N.ClH/c1-17(2)10-9-16-14-7-3-5-12(14)11-13-6-4-8-15(13)16;/h11H,3-10H2,1-2H3;1H |
| InChiKey: | InChIKey=LDSBPWLERIGBPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.