* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,7A-DIHYDRO-2,2,4,6,6-PENTAMETHYL-1,3-BENZODIOXOL-5(6H)-ONE |
| CAS: | 83020-74-0 ;80736-99-8 |
| English Synonyms: | (S)-7,7A-DIHYDRO-2,2,4,6,6-PENTAMETHYL-1,3-BENZODIOXOL-5(6H)-ONE ; 2,2,4,6,6-PENTAMETHYL-7,7A-DIHYDRO-6H-BENZO[1,3]DIOXOL-5-ONE ; 7,7A-DIHYDRO-2,2,4,6,6-PENTAMETHYL-1,3-BENZODIOXOL-5(6H)-ONE ; 1,3-BENZODIOXOL-5(6H)-ONE, 7,7A-DIHYDRO-2,2,4,6,6-PENTAMETHYL- |
| MDL Number.: | MFCD11112089 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC1=C2C(CC(C1=O)(C)C)OC(O2)(C)C |
| InChi: | InChI=1S/C12H18O3/c1-7-9-8(14-12(4,5)15-9)6-11(2,3)10(7)13/h8H,6H2,1-5H3 |
| InChiKey: | InChIKey=XNMQNTGJBBMQIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.