* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H,5H-CYCLOPENTA[5,6][1,4]DIOXINO[2,3-D]IMIDAZOLE |
CAS: | 830357-28-3 |
English Synonyms: | 1H,5H-CYCLOPENTA[5,6][1,4]DIOXINO[2,3-D]IMIDAZOLE |
MDL Number.: | MFCD17017798 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1[nH]c2c(n1)OC3=C(O2)C=CC3 |
InChi: | InChI=1S/C8H6N2O2/c1-2-5-6(3-1)12-8-7(11-5)9-4-10-8/h1-2,4H,3H2,(H,9,10) |
InChiKey: | InChIKey=VQQZPXXJMHFOKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.