* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (-)-ECG-3''-O-ME |
CAS: | 83104-86-3 |
English Synonyms: | (-)-EPICATECHIN 3-(3''-O-METHYL)GALLATE ; (-)-ECG-3''-O-ME ; (-)-EPICATECHIN-3-(3-O-METHYL) GALLATE |
MDL Number.: | MFCD06799448 |
H bond acceptor: | 10 |
H bond donor: | 6 |
Smile: | COc1cc(cc(c1O)O)C(=O)O[C@@H]2Cc3c(cc(cc3O[C@@H]2c4ccc(c(c4)O)O)O)O |
InChi: | InChI=1S/C23H20O10/c1-31-19-6-11(5-17(28)21(19)29)23(30)33-20-9-13-15(26)7-12(24)8-18(13)32-22(20)10-2-3-14(25)16(27)4-10/h2-8,20,22,24-29H,9H2,1H3/t20-,22-/m1/s1 |
InChiKey: | InChIKey=XGTBMCGGGJLOPS-IFMALSPDSA-N |
Property |
|
Comments: | ASSAY (HPLC) |
Specification: | EXTRA PURE REAGENT |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.