* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BENZO[1,2-C:3,4-C]DIISOXAZOLE |
CAS: | 831222-24-3 |
English Synonyms: | BENZO[1,2-C:3,4-C]DIISOXAZOLE |
MDL Number.: | MFCD04004228 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2c(con2)c3c1con3 |
InChi: | InChI=1S/C8H4N2O2/c1-2-7-6(4-12-9-7)8-5(1)3-11-10-8/h1-4H |
InChiKey: | InChIKey=WMXJZOMFHMZNNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.