* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AMINO-1,3-OXAZOL-4-OL |
CAS: | 832133-89-8 |
English Synonyms: | 2-AMINO-4-OXAZOLOL ; 4-OXAZOLOL, 2-AMINO- ; 2-AMINO-1,3-OXAZOL-4-OL |
MDL Number.: | MFCD16989340 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c(nc(o1)N)O |
InChi: | InChI=1S/C3H4N2O2/c4-3-5-2(6)1-7-3/h1,6H,(H2,4,5) |
InChiKey: | InChIKey=JVZHDEANCDIUFQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.