* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-BROMO-5-CHLORO-3H-IMIDAZO[4,5-B]PYRIDINE |
CAS: | 83472-63-3 |
English Synonyms: | 6-BROMO-5-CHLORO-3H-IMIDAZO[4,5-B]PYRIDINE |
MDL Number.: | MFCD16877666 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c2c([nH]cn2)nc(c1Br)Cl |
InChi: | InChI=1S/C6H3BrClN3/c7-3-1-4-6(10-2-9-4)11-5(3)8/h1-2H,(H,9,10,11) |
InChiKey: | InChIKey=YFPJFGMOCWFLNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.