* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,6-METHANONAPHTH[2,3-B]OXIRENE-2,7-DIOL,1A,2,2A,3,6,6A,7,7A-OCTAHYDRO-,(1AR,2S,2AR,3R,6S,6AR,7R,7AS)-REL- |
CAS: | 835611-74-0 |
English Synonyms: | 3,6-METHANONAPHTH[2,3-B]OXIRENE-2,7-DIOL,1A,2,2A,3,6,6A,7,7A-OCTAHYDRO-,(1AR,2S,2AR,3R,6S,6AR,7R,7AS)-REL- |
MDL Number.: | MFCD17017840 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | [H][C@@]12O[C@]1([H])[C@@H](O)[C@]1([H])[C@@]3([H])C[C@]([H])(C=C3)[C@]1([H])[C@H]2O |
InChi: | InChI=1S/C11H14O3/c12-8-6-4-1-2-5(3-4)7(6)9(13)11-10(8)14-11/h1-2,4-13H,3H2/t4-,5+,6-,7+,8+,9-,10-,11+ |
InChiKey: | InChIKey=ZPHAEWHSWUFALP-WSPNWCDISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.