* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UP 614-04 |
CAS: | 83913-04-6 |
English Synonyms: | UP 614-04 |
MDL Number.: | MFCD01658795 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1c2ccccc2n(c1=O)CC3CNCCO3.Cl |
InChi: | InChI=1S/C13H17N3O2.ClH/c1-15-11-4-2-3-5-12(11)16(13(15)17)9-10-8-14-6-7-18-10;/h2-5,10,14H,6-9H2,1H3;1H |
InChiKey: | InChIKey=QCMQLVDPKSUFDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.