* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-FLUORO-1-OXASPIRO[4.5]DECA-6,9-DIEN-8-ONE |
CAS: | 839694-38-1 |
English Synonyms: | 7-FLUORO-1-OXASPIRO[4.5]DECA-6,9-DIEN-8-ONE ; 1-OXASPIRO[4.5]DECA-6,9-DIEN-8-ONE, 7-FLUORO- |
MDL Number.: | MFCD16877844 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC2(C=CC(=O)C(=C2)F)OC1 |
InChi: | InChI=1S/C9H9FO2/c10-7-6-9(3-1-5-12-9)4-2-8(7)11/h2,4,6H,1,3,5H2 |
InChiKey: | InChIKey=DDOBBLWAIHDDKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.