* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRANO[4,3:3,4]CYCLOPENT[1,2-D]ISOXAZOLE |
CAS: | 839725-81-4 |
English Synonyms: | PYRANO[4,3:3,4]CYCLOPENT[1,2-D]ISOXAZOLE |
MDL Number.: | MFCD17017851 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cocc-2c3c(cc12)cno3 |
InChi: | InChI=1S/C9H5NO2/c1-2-11-5-8-6(1)3-7-4-10-12-9(7)8/h1-5H |
InChiKey: | InChIKey=WENUEDMKPDQMJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.