Molecular Structure:
CAS No.:
840481-49-4
Product Name.:
CCD No.:CCD02191759
Formula:C7 H4 Br F2 N O
MolWeight:236.015
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(1)
- Spectrum(0)
- MSDS(1)
- Price(2)
|
|
| Product Name： | 4-BROMO-2,6-DIFLUOROBENZAMIDE |
| CAS： | 840481-49-4 |
| English Synonyms： | 4-BROMO-2,6-DIFLUOROBENZAMIDE |
| MDL Number.： | MFCD13689151 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1c(cc(c(c1F)C(=O)N)F)Br |
| InChi： | InChI=1S/C7H4BrF2NO/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H2,11,12) |
| InChiKey： | InChIKey=VYGSRKKGNFFTNB-UHFFFAOYSA-N |
|
|
| Comments： | HAZARD: R 36/37/38 HAZARD: S 26-37 TSCA: N UNSPSC: 12000000 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
