* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RAMIXOTIDINE |
CAS: | 84071-15-8 |
English Synonyms: | RAMIXOTIDINE |
MDL Number.: | MFCD00866888 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CN(C)Cc1ccc(o1)CSCCNC(=O)c2ccc[n+](c2)[O-] |
InChi: | InChI=1S/C16H21N3O3S/c1-18(2)11-14-5-6-15(22-14)12-23-9-7-17-16(20)13-4-3-8-19(21)10-13/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,17,20) |
InChiKey: | InChIKey=HIVRCMFJEMKPDS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.