* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3,5-TRIFLUORO-2,4,6-TRIIODOBENZENE |
CAS: | 84322-56-5 |
English Synonyms: | 1,3,5-TRILFLUORO-2,4,6-TRIIODOBENZENE ; 1,3,5-TRIFLUORO-2,4,6-TRIIODOBENZENE |
MDL Number.: | MFCD06248899 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1(c(c(c(c(c1I)F)I)F)I)F |
InChi: | InChI=1S/C6F3I3/c7-1-4(10)2(8)6(12)3(9)5(1)11 |
InChiKey: | InChIKey=NTAZOPPTLZSXQH-UHFFFAOYSA-N |
Property |
|
Melting Point: | 152 DEG C |
Comments: | HAZARD: R 36/37/38 HAZARD: S 26-37-60 TSCA: N UNSPSC: 12000000 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.