* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-ISOPROPYL-1,3,4-THIADIAZOL-2(3H)-ONE |
CAS: | 84352-67-0 |
English Synonyms: | 5-ISOPROPYL-1,3,4-THIADIAZOL-2(3H)-ONE |
MDL Number.: | MFCD22207954 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)c1n[nH]c(=O)s1 |
InChi: | InChI=1S/C5H8N2OS/c1-3(2)4-6-7-5(8)9-4/h3H,1-2H3,(H,7,8) |
InChiKey: | InChIKey=BHDJAZDRPCNHLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.