* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BUTYL-3-METHYL-1H-PYRAZOL-5-OL |
CAS: | 844693-03-4 |
English Synonyms: | 1H-PYRAZOL-5-OL, 1-BUTYL-3-METHYL- ; 1-BUTYL-3-METHYL-1H-PYRAZOL-5-OL |
MDL Number.: | MFCD16877853 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCn1c(cc(n1)C)O |
InChi: | InChI=1S/C8H14N2O/c1-3-4-5-10-8(11)6-7(2)9-10/h6,11H,3-5H2,1-2H3 |
InChiKey: | InChIKey=HBOUEUNPQOUCAB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.