* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PROLINE, 4-PROPOXY-, (4S)- |
| CAS: | 845658-56-2 |
| English Synonyms: | L-PROLINE, 4-PROPOXY-, (4S)- |
| MDL Number.: | MFCD17017875 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCO[C@H]1C[C@H](NC1)C(=O)O |
| InChi: | InChI=1S/C8H15NO3/c1-2-3-12-6-4-7(8(10)11)9-5-6/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7-/m0/s1 |
| InChiKey: | InChIKey=AZDNHPLXONKNHP-BQBZGAKWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.