* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(3,4-DIHYDRO-2H-PYRROL-5-YL)QUINOLINE |
| CAS: | 847248-44-6 |
| English Synonyms: | 6-(3,4-DIHYDRO-2H-PYRROL-5-YL)QUINOLINE ; 6-(4,5-DIHYDRO-3H-PYRROL-2-YL)-QUINOLINE |
| MDL Number.: | MFCD09749696 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2cc(ccc2nc1)C3=NCCC3 |
| InChi: | InChI=1S/C13H12N2/c1-3-10-9-11(12-4-2-8-14-12)5-6-13(10)15-7-1/h1,3,5-7,9H,2,4,8H2 |
| InChiKey: | InChIKey=IAPOJJPFEQXKLL-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.