* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ISORORIDIN A |
CAS: | 84773-08-0 |
English Synonyms: | ISORORIDIN A |
MDL Number.: | MFCD08457934 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | C[C@@H]1CCO[C@H](/C=C/C=C\C(=O)O[C@@H]2C[C@@H]3[C@]4([C@]2([C@]5(CCC(=C[C@H]5O3)C)COC(=O)[C@H]1O)C)CO4)[C@H](C)O |
InChi: | InChI=1S/C29H40O9/c1-17-9-11-28-15-35-26(33)25(32)18(2)10-12-34-20(19(3)30)7-5-6-8-24(31)38-21-14-23(37-22(28)13-17)29(16-36-29)27(21,28)4/h5-8,13,18-23,25,30,32H,9-12,14-16H2,1-4H3/b7-5+,8-6-/t18-,19+,20-,21-,22-,23-,25+,27-,28-,29+/m1/s1 |
InChiKey: | InChIKey=NSFWWJIQIKBZMJ-NYUDFZJYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.