* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-PYRAN-2-ONE |
| CAS: | 847822-69-9 |
| English Synonyms: | 5-CHLORO-PYRAN-2-ONE ; 5-CHLORO-2H-PYRAN-2-ONE |
| MDL Number.: | MFCD09030764 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc(=O)occ1Cl |
| InChi: | InChI=1S/C5H3ClO2/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChiKey: | InChIKey=VJTLPUOIBRMNAR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.