* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (2E)-4-(1H-IMIDAZOL-4-YL)BUT-2-ENOIC ACID |
| CAS: | 853295-07-5 ;848133-10-8 |
| English Synonyms: | (2E)-4-(1H-IMIDAZOL-4-YL)BUT-2-ENOIC ACID ; (E)-4-(1H-IMIDAZOL-4-YL)BUT-2-ENOIC ACID |
| MDL Number.: | MFCD09039170 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1c(nc[nH]1)C/C=C/C(=O)O |
| InChi: | InChI=1S/C7H8N2O2/c10-7(11)3-1-2-6-4-8-5-9-6/h1,3-5H,2H2,(H,8,9)(H,10,11)/b3-1+ |
| InChiKey: | InChIKey=MXSQSIOULZCQTD-HNQUOIGGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.