Molecular Structure:
CAS No.:
848169-93-7
Product Name.:
CCD No.:CCD03257893
Formula:C6 H4 Cl2 O . H2 O
MolWeight:181.017
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | PHENOL, 2,4-DICHLORO-, MONOHYDRATE |
| CAS： | 848169-93-7 |
| English Synonyms： | PHENOL, 2,4-DICHLORO-, MONOHYDRATE |
| MDL Number.： | MFCD16877892 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1Cl)Cl)O.O |
| InChi： | InChI=1S/C6H4Cl2O.H2O/c7-4-1-2-6(9)5(8)3-4;/h1-3,9H;1H2 |
| InChiKey： | InChIKey=DBRRHEXMWXEJFE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
