* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(1-AZEPANYL)-3-PYRIDINAMINE |
| CAS: | 850040-18-5 |
| English Synonyms: | 6-(1-AZEPANYL)-3-PYRIDINAMINE ; 6-AZEPAN-1-YLPYRIDIN-3-AMINE |
| MDL Number.: | MFCD08700222 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(ncc1N)N2CCCCCC2 |
| InChi: | InChI=1S/C11H17N3/c12-10-5-6-11(13-9-10)14-7-3-1-2-4-8-14/h5-6,9H,1-4,7-8,12H2 |
| InChiKey: | InChIKey=OZECTFWTIKJUJU-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.