* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-BROMO-SPIRO[INDAN-2,2'-(1,3-OXATHIANE)] |
| CAS: | 850349-54-1 |
| English Synonyms: | 5-BROMO-SPIRO[INDAN-2,2'-(1,3-OXATHIANE)] |
| MDL Number.: | MFCD08706148 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1Br)CCC23OCCCS3 |
| InChi: | InChI=1S/C12H13BrOS/c13-10-2-3-11-9(8-10)4-5-12(11)14-6-1-7-15-12/h2-3,8H,1,4-7H2 |
| InChiKey: | InChIKey=RQBCYRANQJUCEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.