* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,4]DIAZEPAN-1-YL-[4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PHENYL]-METHANONE |
CAS: | 850411-05-1 |
English Synonyms: | [1,4]DIAZEPAN-1-YL-[4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PHENYL]-METHANONE |
MDL Number.: | MFCD06657705 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(cc2)C(=O)N3CCCNCC3 |
InChi: | InChI=1S/C18H27BN2O3/c1-17(2)18(3,4)24-19(23-17)15-8-6-14(7-9-15)16(22)21-12-5-10-20-11-13-21/h6-9,20H,5,10-13H2,1-4H3 |
InChiKey: | InChIKey=STEXODMUTIVWCN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.