* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6H-PURIN-6-ONE, 2-AMINO-1,4,5,9-TETRAHYDRO-, 7-OXIDE |
CAS: | 851071-22-2 |
English Synonyms: | 6H-PURIN-6-ONE, 2-AMINO-1,4,5,9-TETRAHYDRO-, 7-OXIDE |
MDL Number.: | MFCD16877953 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | C1=[N+](C2C(N1)N=C(NC2=O)N)[O-] |
InChi: | InChI=1S/C5H7N5O2/c6-5-8-3-2(4(11)9-5)10(12)1-7-3/h1-3,7H,(H3,6,8,9,11) |
InChiKey: | InChIKey=PJQJQCDGRCCSKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.