* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,8-DIHYDRO-IMIDAZO[1,2-A]PYRAZINE-3,6(2H,5H)-DIONE |
| CAS: | 851431-67-9 |
| English Synonyms: | IMIDAZO[1,2-A]PYRAZINE-3,6(2H,5H)-DIONE, 7,8-DIHYDRO- ; 7,8-DIHYDRO-IMIDAZO[1,2-A]PYRAZINE-3,6(2H,5H)-DIONE |
| MDL Number.: | MFCD16877965 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1C2=NCC(=O)N2CC(=O)N1 |
| InChi: | InChI=1S/C6H7N3O2/c10-5-3-9-4(1-8-5)7-2-6(9)11/h1-3H2,(H,8,10) |
| InChiKey: | InChIKey=PCRYGYHXKSYRGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.