* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(BIPHENYL-4-YL)-3-PROPYLTHIOUREA |
CAS: | 851904-80-8 |
English Synonyms: | 1-(BIPHENYL-4-YL)-3-PROPYLTHIOUREA |
MDL Number.: | MFCD06388417 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCCNC(=S)Nc1ccc(cc1)c2ccccc2 |
InChi: | InChI=1S/C16H18N2S/c1-2-12-17-16(19)18-15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-11H,2,12H2,1H3,(H2,17,18,19) |
InChiKey: | InChIKey=NHXKPBRAGNLSHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.