* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(4-METHYLPHENYL)PIPERIDINE |
| CAS: | 85237-66-7 |
| English Synonyms: | 2-(4-METHYLPHENYL)PIPERIDINE ; ABLOCK AB-12-5186 |
| MDL Number.: | MFCD02663600 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)C2CCCCN2 |
| InChi: | InChI=1S/C12H17N/c1-10-5-7-11(8-6-10)12-4-2-3-9-13-12/h5-8,12-13H,2-4,9H2,1H3 |
| InChiKey: | InChIKey=RPMPQNRTPBUGIW-UHFFFAOYSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.