* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1-CHLOROETHYL)-5-(THIOPHEN-2-YL)-1,3,4-OXADIAZOLE |
CAS: | 854357-49-6 |
English Synonyms: | 2-(1-CHLOROETHYL)-5-THIEN-2-YL-1,3,4-OXADIAZOLE ; 2-(1-CHLOROETHYL)-5-(THIOPHEN-2-YL)-1,3,4-OXADIAZOLE |
MDL Number.: | MFCD06655916 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(c1nnc(o1)c2cccs2)Cl |
InChi: | InChI=1S/C8H7ClN2OS/c1-5(9)7-10-11-8(12-7)6-3-2-4-13-6/h2-5H,1H3 |
InChiKey: | InChIKey=NJHQJNCNBUTPBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.