* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-DIMETHYL-1-OXASPIRO[2.5]OCTANE |
CAS: | 855398-51-5 |
English Synonyms: | 1-OXASPIRO[2.5]OCTANE, 2,4-DIMETHYL- ; 2,4-DIMETHYL-1-OXASPIRO[2.5]OCTANE |
MDL Number.: | MFCD16878083 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC1CCCCC12C(O2)C |
InChi: | InChI=1S/C9H16O/c1-7-5-3-4-6-9(7)8(2)10-9/h7-8H,3-6H2,1-2H3 |
InChiKey: | InChIKey=ZNCBSKPVAIPBRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.